C19H18N4O4S — CID 50778913
3-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)-N-(4-sulfamoylphenyl)benzamide (PubChem CID 50778913) has the molecular formula C19H18N4O4S and a molecular weight of 398.44 g/mol. Its IUPAC name is 3-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)-N-(4-sulfamoylphenyl)benzamide.
| Compound Name | 3-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)-N-(4-sulfamoylphenyl)benzamide |
|---|---|
| PubChem CID | 50778913 |
| Molecular Formula | C19H18N4O4S |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 3-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)-N-(4-sulfamoylphenyl)benzamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)c2cccc(-c3noc(C4CCC4)n3)c2)cc1 |
| InChI | InChI=1S/C19H18N4O4S/c20-28(25,26)16-9-7-15(8-10-16)21-18(24)14-6-2-5-13(11-14)17-22-19(27-23-17)12-3-1-4-12/h2,5-12H,1,3-4H2,(H,21,24)(H2,20,25,26) |
| InChIKey | JGEYIYHPULRYCK-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 128.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |