C16H16N8O4S2 — CID 50779213
1-(furan-2-ylmethyl)-3-[5-(1,3,7-trimethyl-2,6-dioxopurin-8-yl)sulfanyl-1,3,4-thiadiazol-2-yl]urea (PubChem CID 50779213) has the molecular formula C16H16N8O4S2 and a molecular weight of 448.49 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-3-[5-(1,3,7-trimethyl-2,6-dioxopurin-8-yl)sulfanyl-1,3,4-thiadiazol-2-yl]urea.
| Compound Name | 1-(furan-2-ylmethyl)-3-[5-(1,3,7-trimethyl-2,6-dioxopurin-8-yl)sulfanyl-1,3,4-thiadiazol-2-yl]urea |
|---|---|
| PubChem CID | 50779213 |
| Molecular Formula | C16H16N8O4S2 |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.07 |
| IUPAC Name | 1-(furan-2-ylmethyl)-3-[5-(1,3,7-trimethyl-2,6-dioxopurin-8-yl)sulfanyl-1,3,4-thiadiazol-2-yl]urea |
| SMILES | Cn1c(=O)c2c(nc(Sc3nnc(NC(=O)NCc4ccco4)s3)n2C)n(C)c1=O |
| InChI | InChI=1S/C16H16N8O4S2/c1-22-9-10(23(2)16(27)24(3)11(9)25)18-14(22)30-15-21-20-13(29-15)19-12(26)17-7-8-5-4-6-28-8/h4-6H,7H2,1-3H3,(H2,17,19,20,26) |
| InChIKey | SLCGNNZNSAZLFK-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 141.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|