C18H16F2N2O2S — CID 5077933
N-(4-ethoxy-3-ethyl-1,3-benzothiazol-2-ylidene)-2,6-difluorobenzamide (PubChem CID 5077933) has the molecular formula C18H16F2N2O2S and a molecular weight of 362.40 g/mol. Its IUPAC name is N-(4-ethoxy-3-ethyl-1,3-benzothiazol-2-ylidene)-2,6-difluorobenzamide.
| Compound Name | N-(4-ethoxy-3-ethyl-1,3-benzothiazol-2-ylidene)-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 5077933 |
| Molecular Formula | C18H16F2N2O2S |
| Molecular Weight | 362.40 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | N-(4-ethoxy-3-ethyl-1,3-benzothiazol-2-ylidene)-2,6-difluorobenzamide |
| SMILES | CCOc1cccc2s/c(=N\C(=O)c3c(F)cccc3F)n(CC)c12 |
| InChI | InChI=1S/C18H16F2N2O2S/c1-3-22-16-13(24-4-2)9-6-10-14(16)25-18(22)21-17(23)15-11(19)7-5-8-12(15)20/h5-10H,3-4H2,1-2H3/b21-18- |
| InChIKey | CJYDCNMDYFYKJL-UZYVYHOESA-N |
| XLogP | 4.14 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.40 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |