C22H35N5O3 — CID 50779385
3-acetamido-N-[2-(diethylamino)ethyl]-N-(3-oxo-3-piperazin-1-ylpropyl)benzamide (PubChem CID 50779385) has the molecular formula C22H35N5O3 and a molecular weight of 417.55 g/mol. Its IUPAC name is 3-acetamido-N-[2-(diethylamino)ethyl]-N-(3-oxo-3-piperazin-1-ylpropyl)benzamide.
| Compound Name | 3-acetamido-N-[2-(diethylamino)ethyl]-N-(3-oxo-3-piperazin-1-ylpropyl)benzamide |
|---|---|
| PubChem CID | 50779385 |
| Molecular Formula | C22H35N5O3 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.27 |
| IUPAC Name | 3-acetamido-N-[2-(diethylamino)ethyl]-N-(3-oxo-3-piperazin-1-ylpropyl)benzamide |
| SMILES | CCN(CC)CCN(CCC(=O)N1CCNCC1)C(=O)c1cccc(NC(C)=O)c1 |
| InChI | InChI=1S/C22H35N5O3/c1-4-25(5-2)15-16-27(12-9-21(29)26-13-10-23-11-14-26)22(30)19-7-6-8-20(17-19)24-18(3)28/h6-8,17,23H,4-5,9-16H2,1-3H3,(H,24,28) |
| InChIKey | WBVIYRCAWKRLQJ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |