C21H31N3O4 — CID 50779422
N-cyclopentyl-3,4-dimethoxy-N-(3-oxo-3-piperazin-1-ylpropyl)benzamide (PubChem CID 50779422) has the molecular formula C21H31N3O4 and a molecular weight of 389.50 g/mol. Its IUPAC name is N-cyclopentyl-3,4-dimethoxy-N-(3-oxo-3-piperazin-1-ylpropyl)benzamide.
| Compound Name | N-cyclopentyl-3,4-dimethoxy-N-(3-oxo-3-piperazin-1-ylpropyl)benzamide |
|---|---|
| PubChem CID | 50779422 |
| Molecular Formula | C21H31N3O4 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.23 |
| IUPAC Name | N-cyclopentyl-3,4-dimethoxy-N-(3-oxo-3-piperazin-1-ylpropyl)benzamide |
| SMILES | COc1ccc(C(=O)N(CCC(=O)N2CCNCC2)C2CCCC2)cc1OC |
| InChI | InChI=1S/C21H31N3O4/c1-27-18-8-7-16(15-19(18)28-2)21(26)24(17-5-3-4-6-17)12-9-20(25)23-13-10-22-11-14-23/h7-8,15,17,22H,3-6,9-14H2,1-2H3 |
| InChIKey | DNDWUKUQGCPPIV-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |