C25H29ClN4O4 — CID 50781002
5-(4-carbamoyl-4-piperidin-1-ylpiperidin-1-yl)-2-[(2-chlorobenzoyl)amino]benzoic acid (PubChem CID 50781002) has the molecular formula C25H29ClN4O4 and a molecular weight of 484.98 g/mol. Its IUPAC name is 5-(4-carbamoyl-4-piperidin-1-ylpiperidin-1-yl)-2-[(2-chlorobenzoyl)amino]benzoic acid.
| Compound Name | 5-(4-carbamoyl-4-piperidin-1-ylpiperidin-1-yl)-2-[(2-chlorobenzoyl)amino]benzoic acid |
|---|---|
| PubChem CID | 50781002 |
| Molecular Formula | C25H29ClN4O4 |
| Molecular Weight | 484.98 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | 5-(4-carbamoyl-4-piperidin-1-ylpiperidin-1-yl)-2-[(2-chlorobenzoyl)amino]benzoic acid |
| SMILES | NC(=O)C1(N2CCCCC2)CCN(c2ccc(NC(=O)c3ccccc3Cl)c(C(=O)O)c2)CC1 |
| InChI | InChI=1S/C25H29ClN4O4/c26-20-7-3-2-6-18(20)22(31)28-21-9-8-17(16-19(21)23(32)33)29-14-10-25(11-15-29,24(27)34)30-12-4-1-5-13-30/h2-3,6-9,16H,1,4-5,10-15H2,(H2,27,34)(H,28,31)(H,32,33) |
| InChIKey | FLLFPJJSGWCAJZ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.98 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |