C27H35N5O3 — CID 50781590
1-[4-[(4-methylphenyl)methyl]-3-oxopyrido[2,3-b]pyrazin-2-yl]-N-(3-propan-2-yloxypropyl)piperidine-3-carboxamide (PubChem CID 50781590) has the molecular formula C27H35N5O3 and a molecular weight of 477.61 g/mol. Its IUPAC name is 1-[4-[(4-methylphenyl)methyl]-3-oxopyrido[2,3-b]pyrazin-2-yl]-N-(3-propan-2-yloxypropyl)piperidine-3-carboxamide.
| Compound Name | 1-[4-[(4-methylphenyl)methyl]-3-oxopyrido[2,3-b]pyrazin-2-yl]-N-(3-propan-2-yloxypropyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 50781590 |
| Molecular Formula | C27H35N5O3 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.27 |
| IUPAC Name | 1-[4-[(4-methylphenyl)methyl]-3-oxopyrido[2,3-b]pyrazin-2-yl]-N-(3-propan-2-yloxypropyl)piperidine-3-carboxamide |
| SMILES | Cc1ccc(Cn2c(=O)c(N3CCCC(C(=O)NCCCOC(C)C)C3)nc3cccnc32)cc1 |
| InChI | InChI=1S/C27H35N5O3/c1-19(2)35-16-6-14-29-26(33)22-7-5-15-31(18-22)25-27(34)32(17-21-11-9-20(3)10-12-21)24-23(30-25)8-4-13-28-24/h4,8-13,19,22H,5-7,14-18H2,1-3H3,(H,29,33) |
| InChIKey | OTVFKYKHRDKWGA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|