About 2-(4-methyl-1,4-diazepan-1-yl)-6-[(2-phenoxyacetyl)amino]quinoline-4-carboxylic acid
2-(4-methyl-1,4-diazepan-1-yl)-6-[(2-phenoxyacetyl)amino]quinoline-4-carboxylic acid (PubChem CID 50783033) has the molecular formula C24H26N4O4
and a molecular weight of 434.50 g/mol. Its IUPAC name is 2-(4-methyl-1,4-diazepan-1-yl)-6-[(2-phenoxyacetyl)amino]quinoline-4-carboxylic acid.
Molecular Properties
| Compound Name | 2-(4-methyl-1,4-diazepan-1-yl)-6-[(2-phenoxyacetyl)amino]quinoline-4-carboxylic acid |
| PubChem CID | 50783033 |
| Molecular Formula | C24H26N4O4 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 2-(4-methyl-1,4-diazepan-1-yl)-6-[(2-phenoxyacetyl)amino]quinoline-4-carboxylic acid |
| SMILES | CN1CCCN(c2cc(C(=O)O)c3cc(NC(=O)COc4ccccc4)ccc3n2)CC1 |
| InChI | InChI=1S/C24H26N4O4/c1-27-10-5-11-28(13-12-27)22-15-20(24(30)31)19-14-17(8-9-21(19)26-22)25-23(29)16-32-18-6-3-2-4-7-18/h2-4,6-9,14-15H,5,10-13,16H2,1H3,(H,25,29)(H,30,31) |
| InChIKey | DOPUVXKSCYLFBR-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 95.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(4-methyl-1,4-diazepan-1-yl)-6-[(2-phenoxyacetyl)amino]quinoline-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methyl-1,4-diazepan-1-yl)-6-[(2-phenoxyacetyl)amino]quinoline-4-carboxylic acid?
The IUPAC name of 2-(4-methyl-1,4-diazepan-1-yl)-6-[(2-phenoxyacetyl)amino]quinoline-4-carboxylic acid (CID 50783033) is 2-(4-methyl-1,4-diazepan-1-yl)-6-[(2-phenoxyacetyl)amino]quinoline-4-carboxylic acid.
What is the SMILES notation for 2-(4-methyl-1,4-diazepan-1-yl)-6-[(2-phenoxyacetyl)amino]quinoline-4-carboxylic acid?
The canonical SMILES for 2-(4-methyl-1,4-diazepan-1-yl)-6-[(2-phenoxyacetyl)amino]quinoline-4-carboxylic acid is CN1CCCN(c2cc(C(=O)O)c3cc(NC(=O)COc4ccccc4)ccc3n2)CC1.
What is the InChIKey of 2-(4-methyl-1,4-diazepan-1-yl)-6-[(2-phenoxyacetyl)amino]quinoline-4-carboxylic acid?
The InChIKey is DOPUVXKSCYLFBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26N4O4/c1-27-10-5-11-28(13-12-27)22-15-20(24(30)31)19-14-17(8-9-21(19)26-22)25-23(29)16-32-18-6-3-2-4-7-18/h2-4,6-9,14-15H,5,10-13,16H2,1H3,(H,25,29)(H,30,31).
What are the key properties of 2-(4-methyl-1,4-diazepan-1-yl)-6-[(2-phenoxyacetyl)amino]quinoline-4-carboxylic acid?
2-(4-methyl-1,4-diazepan-1-yl)-6-[(2-phenoxyacetyl)amino]quinoline-4-carboxylic acid has a molecular weight of 434.50 g/mol, XLogP of 3.09, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methyl-1,4-diazepan-1-yl)-6-[(2-phenoxyacetyl)amino]quinoline-4-carboxylic acid is sourced from PubChem (CID 50783033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).