About 2-(3,4-dimethoxyanilino)-N-(3-morpholin-4-ylsulfonylphenyl)propanamide
2-(3,4-dimethoxyanilino)-N-(3-morpholin-4-ylsulfonylphenyl)propanamide (PubChem CID 5078319) has the molecular formula C21H27N3O6S
and a molecular weight of 449.53 g/mol. Its IUPAC name is 2-(3,4-dimethoxyanilino)-N-(3-morpholin-4-ylsulfonylphenyl)propanamide.
Molecular Properties
| Compound Name | 2-(3,4-dimethoxyanilino)-N-(3-morpholin-4-ylsulfonylphenyl)propanamide |
| PubChem CID | 5078319 |
| Molecular Formula | C21H27N3O6S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | 2-(3,4-dimethoxyanilino)-N-(3-morpholin-4-ylsulfonylphenyl)propanamide |
| SMILES | COc1ccc(NC(C)C(=O)Nc2cccc(S(=O)(=O)N3CCOCC3)c2)cc1OC |
| InChI | InChI=1S/C21H27N3O6S/c1-15(22-17-7-8-19(28-2)20(14-17)29-3)21(25)23-16-5-4-6-18(13-16)31(26,27)24-9-11-30-12-10-24/h4-8,13-15,22H,9-12H2,1-3H3,(H,23,25) |
| InChIKey | FCCJVYFZBSSILV-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,4-dimethoxyanilino)-N-(3-morpholin-4-ylsulfonylphenyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dimethoxyanilino)-N-(3-morpholin-4-ylsulfonylphenyl)propanamide?
The IUPAC name of 2-(3,4-dimethoxyanilino)-N-(3-morpholin-4-ylsulfonylphenyl)propanamide (CID 5078319) is 2-(3,4-dimethoxyanilino)-N-(3-morpholin-4-ylsulfonylphenyl)propanamide.
What is the SMILES notation for 2-(3,4-dimethoxyanilino)-N-(3-morpholin-4-ylsulfonylphenyl)propanamide?
The canonical SMILES for 2-(3,4-dimethoxyanilino)-N-(3-morpholin-4-ylsulfonylphenyl)propanamide is COc1ccc(NC(C)C(=O)Nc2cccc(S(=O)(=O)N3CCOCC3)c2)cc1OC.
What is the InChIKey of 2-(3,4-dimethoxyanilino)-N-(3-morpholin-4-ylsulfonylphenyl)propanamide?
The InChIKey is FCCJVYFZBSSILV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H27N3O6S/c1-15(22-17-7-8-19(28-2)20(14-17)29-3)21(25)23-16-5-4-6-18(13-16)31(26,27)24-9-11-30-12-10-24/h4-8,13-15,22H,9-12H2,1-3H3,(H,23,25).
What are the key properties of 2-(3,4-dimethoxyanilino)-N-(3-morpholin-4-ylsulfonylphenyl)propanamide?
2-(3,4-dimethoxyanilino)-N-(3-morpholin-4-ylsulfonylphenyl)propanamide has a molecular weight of 449.53 g/mol, XLogP of 2.16, 8 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dimethoxyanilino)-N-(3-morpholin-4-ylsulfonylphenyl)propanamide is sourced from PubChem (CID 5078319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).