C23H23ClN4O3 — CID 50784144
6-[(3-chlorobenzoyl)amino]-2-(4-ethylpiperazin-1-yl)quinoline-4-carboxylic acid (PubChem CID 50784144) has the molecular formula C23H23ClN4O3 and a molecular weight of 438.92 g/mol. Its IUPAC name is 6-[(3-chlorobenzoyl)amino]-2-(4-ethylpiperazin-1-yl)quinoline-4-carboxylic acid.
| Compound Name | 6-[(3-chlorobenzoyl)amino]-2-(4-ethylpiperazin-1-yl)quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 50784144 |
| Molecular Formula | C23H23ClN4O3 |
| Molecular Weight | 438.92 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | 6-[(3-chlorobenzoyl)amino]-2-(4-ethylpiperazin-1-yl)quinoline-4-carboxylic acid |
| SMILES | CCN1CCN(c2cc(C(=O)O)c3cc(NC(=O)c4cccc(Cl)c4)ccc3n2)CC1 |
| InChI | InChI=1S/C23H23ClN4O3/c1-2-27-8-10-28(11-9-27)21-14-19(23(30)31)18-13-17(6-7-20(18)26-21)25-22(29)15-4-3-5-16(24)12-15/h3-7,12-14H,2,8-11H2,1H3,(H,25,29)(H,30,31) |
| InChIKey | FRAQZBJVAOATCS-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.92 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |