C24H20N4O3 — CID 50784468
N-[(2-methylphenyl)methyl]-5-[(7-oxo-2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-8-yl)methyl]furan-2-carboxamide (PubChem CID 50784468) has the molecular formula C24H20N4O3 and a molecular weight of 412.45 g/mol. Its IUPAC name is N-[(2-methylphenyl)methyl]-5-[(7-oxo-2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-8-yl)methyl]furan-2-carboxamide.
| Compound Name | N-[(2-methylphenyl)methyl]-5-[(7-oxo-2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-8-yl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 50784468 |
| Molecular Formula | C24H20N4O3 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | N-[(2-methylphenyl)methyl]-5-[(7-oxo-2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-8-yl)methyl]furan-2-carboxamide |
| SMILES | Cc1ccccc1CNC(=O)c1ccc(Cn2c(=O)c3cccn3c3cccnc32)o1 |
| InChI | InChI=1S/C24H20N4O3/c1-16-6-2-3-7-17(16)14-26-23(29)21-11-10-18(31-21)15-28-22-19(8-4-12-25-22)27-13-5-9-20(27)24(28)30/h2-13H,14-15H2,1H3,(H,26,29) |
| InChIKey | PBAUBWVDZQJHEX-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |