C16H9FN2O2 — CID 50784663
2-(4-fluorophenyl)chromeno[2,3-c]pyrazol-3-one (PubChem CID 50784663) has the molecular formula C16H9FN2O2 and a molecular weight of 280.26 g/mol. Its IUPAC name is 2-(4-fluorophenyl)chromeno[2,3-c]pyrazol-3-one.
| Compound Name | 2-(4-fluorophenyl)chromeno[2,3-c]pyrazol-3-one |
|---|---|
| PubChem CID | 50784663 |
| Molecular Formula | C16H9FN2O2 |
| Molecular Weight | 280.26 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 2-(4-fluorophenyl)chromeno[2,3-c]pyrazol-3-one |
| SMILES | O=c1c2cc3ccccc3oc-2nn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C16H9FN2O2/c17-11-5-7-12(8-6-11)19-16(20)13-9-10-3-1-2-4-14(10)21-15(13)18-19/h1-9H |
| InChIKey | DNCGPCPMEFWMGN-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 48.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.26 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |