C19H19ClN6OS — CID 50786140
N-butan-2-yl-2-[[11-(4-chlorophenyl)-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,10-pentaen-5-yl]sulfanyl]acetamide (PubChem CID 50786140) has the molecular formula C19H19ClN6OS and a molecular weight of 414.92 g/mol. Its IUPAC name is N-butan-2-yl-2-[[11-(4-chlorophenyl)-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,10-pentaen-5-yl]sulfanyl]acetamide.
| Compound Name | N-butan-2-yl-2-[[11-(4-chlorophenyl)-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,10-pentaen-5-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 50786140 |
| Molecular Formula | C19H19ClN6OS |
| Molecular Weight | 414.92 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | N-butan-2-yl-2-[[11-(4-chlorophenyl)-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,10-pentaen-5-yl]sulfanyl]acetamide |
| SMILES | CCC(C)NC(=O)CSc1nnc2c3cc(-c4ccc(Cl)cc4)nn3ccn12 |
| InChI | InChI=1S/C19H19ClN6OS/c1-3-12(2)21-17(27)11-28-19-23-22-18-16-10-15(13-4-6-14(20)7-5-13)24-26(16)9-8-25(18)19/h4-10,12H,3,11H2,1-2H3,(H,21,27) |
| InChIKey | JOOWSALZLIDAEM-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 76.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.92 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |