C22H24N6OS — CID 50786396
N-cyclopentyl-2-[[11-(2,5-dimethylphenyl)-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,10-pentaen-5-yl]sulfanyl]acetamide (PubChem CID 50786396) has the molecular formula C22H24N6OS and a molecular weight of 420.54 g/mol. Its IUPAC name is N-cyclopentyl-2-[[11-(2,5-dimethylphenyl)-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,10-pentaen-5-yl]sulfanyl]acetamide.
| Compound Name | N-cyclopentyl-2-[[11-(2,5-dimethylphenyl)-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,10-pentaen-5-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 50786396 |
| Molecular Formula | C22H24N6OS |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | N-cyclopentyl-2-[[11-(2,5-dimethylphenyl)-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,10-pentaen-5-yl]sulfanyl]acetamide |
| SMILES | Cc1ccc(C)c(-c2cc3c4nnc(SCC(=O)NC5CCCC5)n4ccn3n2)c1 |
| InChI | InChI=1S/C22H24N6OS/c1-14-7-8-15(2)17(11-14)18-12-19-21-24-25-22(27(21)9-10-28(19)26-18)30-13-20(29)23-16-5-3-4-6-16/h7-12,16H,3-6,13H2,1-2H3,(H,23,29) |
| InChIKey | OJSNZJDPNATLFX-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 76.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |