C25H28N4O4S — CID 50787287
N-(3,5-dimethoxyphenyl)-6-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-amine (PubChem CID 50787287) has the molecular formula C25H28N4O4S and a molecular weight of 480.59 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-6-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-amine.
| Compound Name | N-(3,5-dimethoxyphenyl)-6-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 50787287 |
| Molecular Formula | C25H28N4O4S |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-6-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-amine |
| SMILES | COc1cc(Nc2ncc3c(n2)CCN(S(=O)(=O)c2ccc4c(c2)CCCC4)C3)cc(OC)c1 |
| InChI | InChI=1S/C25H28N4O4S/c1-32-21-12-20(13-22(14-21)33-2)27-25-26-15-19-16-29(10-9-24(19)28-25)34(30,31)23-8-7-17-5-3-4-6-18(17)11-23/h7-8,11-15H,3-6,9-10,16H2,1-2H3,(H,26,27,28) |
| InChIKey | VONLAPZUTFGQMW-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |