C18H29N3O4S — CID 50788423
N-(3-methoxypropyl)-2,4-dimethyl-N-(2-oxo-2-piperazin-1-ylethyl)benzenesulfonamide (PubChem CID 50788423) has the molecular formula C18H29N3O4S and a molecular weight of 383.51 g/mol. Its IUPAC name is N-(3-methoxypropyl)-2,4-dimethyl-N-(2-oxo-2-piperazin-1-ylethyl)benzenesulfonamide.
| Compound Name | N-(3-methoxypropyl)-2,4-dimethyl-N-(2-oxo-2-piperazin-1-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 50788423 |
| Molecular Formula | C18H29N3O4S |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | N-(3-methoxypropyl)-2,4-dimethyl-N-(2-oxo-2-piperazin-1-ylethyl)benzenesulfonamide |
| SMILES | COCCCN(CC(=O)N1CCNCC1)S(=O)(=O)c1ccc(C)cc1C |
| InChI | InChI=1S/C18H29N3O4S/c1-15-5-6-17(16(2)13-15)26(23,24)21(9-4-12-25-3)14-18(22)20-10-7-19-8-11-20/h5-6,13,19H,4,7-12,14H2,1-3H3 |
| InChIKey | ODQHDFDREMOSJJ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|