C22H35N3O3S — CID 50788565
N-cycloheptyl-N-(2-oxo-2-piperazin-1-ylethyl)-4-propan-2-ylbenzenesulfonamide (PubChem CID 50788565) has the molecular formula C22H35N3O3S and a molecular weight of 421.61 g/mol. Its IUPAC name is N-cycloheptyl-N-(2-oxo-2-piperazin-1-ylethyl)-4-propan-2-ylbenzenesulfonamide.
| Compound Name | N-cycloheptyl-N-(2-oxo-2-piperazin-1-ylethyl)-4-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 50788565 |
| Molecular Formula | C22H35N3O3S |
| Molecular Weight | 421.61 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | N-cycloheptyl-N-(2-oxo-2-piperazin-1-ylethyl)-4-propan-2-ylbenzenesulfonamide |
| SMILES | CC(C)c1ccc(S(=O)(=O)N(CC(=O)N2CCNCC2)C2CCCCCC2)cc1 |
| InChI | InChI=1S/C22H35N3O3S/c1-18(2)19-9-11-21(12-10-19)29(27,28)25(20-7-5-3-4-6-8-20)17-22(26)24-15-13-23-14-16-24/h9-12,18,20,23H,3-8,13-17H2,1-2H3 |
| InChIKey | BSNGWIUIQAHBNT-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.61 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |