C20H30N4O2 — CID 50788874
N-ethyl-3-[3-(4-methylpiperazine-1-carbonyl)phenyl]piperidine-1-carboxamide (PubChem CID 50788874) has the molecular formula C20H30N4O2 and a molecular weight of 358.49 g/mol. Its IUPAC name is N-ethyl-3-[3-(4-methylpiperazine-1-carbonyl)phenyl]piperidine-1-carboxamide.
| Compound Name | N-ethyl-3-[3-(4-methylpiperazine-1-carbonyl)phenyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 50788874 |
| Molecular Formula | C20H30N4O2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | N-ethyl-3-[3-(4-methylpiperazine-1-carbonyl)phenyl]piperidine-1-carboxamide |
| SMILES | CCNC(=O)N1CCCC(c2cccc(C(=O)N3CCN(C)CC3)c2)C1 |
| InChI | InChI=1S/C20H30N4O2/c1-3-21-20(26)24-9-5-8-18(15-24)16-6-4-7-17(14-16)19(25)23-12-10-22(2)11-13-23/h4,6-7,14,18H,3,5,8-13,15H2,1-2H3,(H,21,26) |
| InChIKey | LQXOXEDDUPOAGW-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |