C24H21FN6O3 — CID 507889
1-(4-benzoylpiperazin-1-yl)-2-[4-fluoro-7-(5-methyl-1H-1,2,4-triazol-3-yl)-1H-indol-3-yl]ethane-1,2-dione (PubChem CID 507889) has the molecular formula C24H21FN6O3 and a molecular weight of 460.47 g/mol. Its IUPAC name is 1-(4-benzoylpiperazin-1-yl)-2-[4-fluoro-7-(5-methyl-1H-1,2,4-triazol-3-yl)-1H-indol-3-yl]ethane-1,2-dione.
| Compound Name | 1-(4-benzoylpiperazin-1-yl)-2-[4-fluoro-7-(5-methyl-1H-1,2,4-triazol-3-yl)-1H-indol-3-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 507889 |
| Molecular Formula | C24H21FN6O3 |
| Molecular Weight | 460.47 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | 1-(4-benzoylpiperazin-1-yl)-2-[4-fluoro-7-(5-methyl-1H-1,2,4-triazol-3-yl)-1H-indol-3-yl]ethane-1,2-dione |
| SMILES | Cc1nc(-c2ccc(F)c3c(C(=O)C(=O)N4CCN(C(=O)c5ccccc5)CC4)c[nH]c23)n[nH]1 |
| InChI | InChI=1S/C24H21FN6O3/c1-14-27-22(29-28-14)16-7-8-18(25)19-17(13-26-20(16)19)21(32)24(34)31-11-9-30(10-12-31)23(33)15-5-3-2-4-6-15/h2-8,13,26H,9-12H2,1H3,(H,27,28,29) |
| InChIKey | BMDHNYLKCAEYAP-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 115.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.47 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|