C19H27N3O2 — CID 50789048
3-[3-(cyclopropylcarbamoyl)phenyl]-N-propan-2-ylpiperidine-1-carboxamide (PubChem CID 50789048) has the molecular formula C19H27N3O2 and a molecular weight of 329.44 g/mol. Its IUPAC name is 3-[3-(cyclopropylcarbamoyl)phenyl]-N-propan-2-ylpiperidine-1-carboxamide.
| Compound Name | 3-[3-(cyclopropylcarbamoyl)phenyl]-N-propan-2-ylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 50789048 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | 3-[3-(cyclopropylcarbamoyl)phenyl]-N-propan-2-ylpiperidine-1-carboxamide |
| SMILES | CC(C)NC(=O)N1CCCC(c2cccc(C(=O)NC3CC3)c2)C1 |
| InChI | InChI=1S/C19H27N3O2/c1-13(2)20-19(24)22-10-4-7-16(12-22)14-5-3-6-15(11-14)18(23)21-17-8-9-17/h3,5-6,11,13,16-17H,4,7-10,12H2,1-2H3,(H,20,24)(H,21,23) |
| InChIKey | WEWGPJKBKSBRQA-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |