C24H25F2N3O2 — CID 50790047
4-(3,5-difluorophenyl)-N-(3-ethoxypropyl)-4,6-dihydropyrrolo[1,2-a][1,4]benzodiazepine-5-carboxamide (PubChem CID 50790047) has the molecular formula C24H25F2N3O2 and a molecular weight of 425.48 g/mol. Its IUPAC name is 4-(3,5-difluorophenyl)-N-(3-ethoxypropyl)-4,6-dihydropyrrolo[1,2-a][1,4]benzodiazepine-5-carboxamide.
| Compound Name | 4-(3,5-difluorophenyl)-N-(3-ethoxypropyl)-4,6-dihydropyrrolo[1,2-a][1,4]benzodiazepine-5-carboxamide |
|---|---|
| PubChem CID | 50790047 |
| Molecular Formula | C24H25F2N3O2 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 4-(3,5-difluorophenyl)-N-(3-ethoxypropyl)-4,6-dihydropyrrolo[1,2-a][1,4]benzodiazepine-5-carboxamide |
| SMILES | CCOCCCNC(=O)N1Cc2ccccc2-n2cccc2C1c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C24H25F2N3O2/c1-2-31-12-6-10-27-24(30)29-16-17-7-3-4-8-21(17)28-11-5-9-22(28)23(29)18-13-19(25)15-20(26)14-18/h3-5,7-9,11,13-15,23H,2,6,10,12,16H2,1H3,(H,27,30) |
| InChIKey | SMZSLDGESGSFBF-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|