C23H19FN6O4 — CID 507902
1-[7-(5-amino-1,3,4-oxadiazol-2-yl)-4-fluoro-1H-indol-3-yl]-2-(4-benzoylpiperazin-1-yl)ethane-1,2-dione (PubChem CID 507902) has the molecular formula C23H19FN6O4 and a molecular weight of 462.44 g/mol. Its IUPAC name is 1-[7-(5-amino-1,3,4-oxadiazol-2-yl)-4-fluoro-1H-indol-3-yl]-2-(4-benzoylpiperazin-1-yl)ethane-1,2-dione.
| Compound Name | 1-[7-(5-amino-1,3,4-oxadiazol-2-yl)-4-fluoro-1H-indol-3-yl]-2-(4-benzoylpiperazin-1-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 507902 |
| Molecular Formula | C23H19FN6O4 |
| Molecular Weight | 462.44 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | 1-[7-(5-amino-1,3,4-oxadiazol-2-yl)-4-fluoro-1H-indol-3-yl]-2-(4-benzoylpiperazin-1-yl)ethane-1,2-dione |
| SMILES | Nc1nnc(-c2ccc(F)c3c(C(=O)C(=O)N4CCN(C(=O)c5ccccc5)CC4)c[nH]c23)o1 |
| InChI | InChI=1S/C23H19FN6O4/c24-16-7-6-14(20-27-28-23(25)34-20)18-17(16)15(12-26-18)19(31)22(33)30-10-8-29(9-11-30)21(32)13-4-2-1-3-5-13/h1-7,12,26H,8-11H2,(H2,25,28) |
| InChIKey | ULHNXKCYBVNKOX-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 138.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.44 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|