C20H22N4O3S2 — CID 50790450
2-[5-amino-4-(benzenesulfonyl)-3-ethylsulfanylpyrazol-1-yl]-N-(4-methylphenyl)acetamide (PubChem CID 50790450) has the molecular formula C20H22N4O3S2 and a molecular weight of 430.56 g/mol. Its IUPAC name is 2-[5-amino-4-(benzenesulfonyl)-3-ethylsulfanylpyrazol-1-yl]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[5-amino-4-(benzenesulfonyl)-3-ethylsulfanylpyrazol-1-yl]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 50790450 |
| Molecular Formula | C20H22N4O3S2 |
| Molecular Weight | 430.56 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | 2-[5-amino-4-(benzenesulfonyl)-3-ethylsulfanylpyrazol-1-yl]-N-(4-methylphenyl)acetamide |
| SMILES | CCSc1nn(CC(=O)Nc2ccc(C)cc2)c(N)c1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H22N4O3S2/c1-3-28-20-18(29(26,27)16-7-5-4-6-8-16)19(21)24(23-20)13-17(25)22-15-11-9-14(2)10-12-15/h4-12H,3,13,21H2,1-2H3,(H,22,25) |
| InChIKey | JDSBZVBOPVXFRV-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.56 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |