C25H28FN3O3S — CID 50790985
4-(4-fluorophenyl)-10-methyl-3-oxo-N-(3-propan-2-yloxypropyl)-5H-[1,4]thiazepino[7,6-b]indole-5-carboxamide (PubChem CID 50790985) has the molecular formula C25H28FN3O3S and a molecular weight of 469.58 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-10-methyl-3-oxo-N-(3-propan-2-yloxypropyl)-5H-[1,4]thiazepino[7,6-b]indole-5-carboxamide.
| Compound Name | 4-(4-fluorophenyl)-10-methyl-3-oxo-N-(3-propan-2-yloxypropyl)-5H-[1,4]thiazepino[7,6-b]indole-5-carboxamide |
|---|---|
| PubChem CID | 50790985 |
| Molecular Formula | C25H28FN3O3S |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | 4-(4-fluorophenyl)-10-methyl-3-oxo-N-(3-propan-2-yloxypropyl)-5H-[1,4]thiazepino[7,6-b]indole-5-carboxamide |
| SMILES | CC(C)OCCCNC(=O)C1c2c(n(C)c3ccccc23)SCC(=O)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C25H28FN3O3S/c1-16(2)32-14-6-13-27-24(31)23-22-19-7-4-5-8-20(19)28(3)25(22)33-15-21(30)29(23)18-11-9-17(26)10-12-18/h4-5,7-12,16,23H,6,13-15H2,1-3H3,(H,27,31) |
| InChIKey | AAYTWJVZZKFOJE-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|