C29H40N4O2 — CID 50791553
N-[4-[2-[3-(2-ethylpiperidin-1-yl)propylamino]-2-oxoethyl]phenyl]-2,3,4,5-tetrahydro-1-benzazepine-1-carboxamide (PubChem CID 50791553) has the molecular formula C29H40N4O2 and a molecular weight of 476.67 g/mol. Its IUPAC name is N-[4-[2-[3-(2-ethylpiperidin-1-yl)propylamino]-2-oxoethyl]phenyl]-2,3,4,5-tetrahydro-1-benzazepine-1-carboxamide.
| Compound Name | N-[4-[2-[3-(2-ethylpiperidin-1-yl)propylamino]-2-oxoethyl]phenyl]-2,3,4,5-tetrahydro-1-benzazepine-1-carboxamide |
|---|---|
| PubChem CID | 50791553 |
| Molecular Formula | C29H40N4O2 |
| Molecular Weight | 476.67 g/mol |
| Exact Mass | 476.32 |
| IUPAC Name | N-[4-[2-[3-(2-ethylpiperidin-1-yl)propylamino]-2-oxoethyl]phenyl]-2,3,4,5-tetrahydro-1-benzazepine-1-carboxamide |
| SMILES | CCC1CCCCN1CCCNC(=O)Cc1ccc(NC(=O)N2CCCCc3ccccc32)cc1 |
| InChI | InChI=1S/C29H40N4O2/c1-2-26-12-6-7-19-32(26)20-9-18-30-28(34)22-23-14-16-25(17-15-23)31-29(35)33-21-8-5-11-24-10-3-4-13-27(24)33/h3-4,10,13-17,26H,2,5-9,11-12,18-22H2,1H3,(H,30,34)(H,31,35) |
| InChIKey | AOCPFBJNKKZTSM-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.67 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|