C21H30N4O3 — CID 50792271
N-[1,4-dimethyl-7-(4-methylpiperidin-1-yl)-2,3-dioxoquinoxalin-6-yl]-2,2-dimethylpropanamide (PubChem CID 50792271) has the molecular formula C21H30N4O3 and a molecular weight of 386.50 g/mol. Its IUPAC name is N-[1,4-dimethyl-7-(4-methylpiperidin-1-yl)-2,3-dioxoquinoxalin-6-yl]-2,2-dimethylpropanamide.
| Compound Name | N-[1,4-dimethyl-7-(4-methylpiperidin-1-yl)-2,3-dioxoquinoxalin-6-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 50792271 |
| Molecular Formula | C21H30N4O3 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | N-[1,4-dimethyl-7-(4-methylpiperidin-1-yl)-2,3-dioxoquinoxalin-6-yl]-2,2-dimethylpropanamide |
| SMILES | CC1CCN(c2cc3c(cc2NC(=O)C(C)(C)C)n(C)c(=O)c(=O)n3C)CC1 |
| InChI | InChI=1S/C21H30N4O3/c1-13-7-9-25(10-8-13)15-12-17-16(23(5)18(26)19(27)24(17)6)11-14(15)22-20(28)21(2,3)4/h11-13H,7-10H2,1-6H3,(H,22,28) |
| InChIKey | SMVCLJUPCUOPAX-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 76.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|