C22H17N5O5S2 — CID 50793162
N-(1,4-dimethyl-2,3-dioxo-7-phenoxyquinoxalin-6-yl)-2,1,3-benzothiadiazole-4-sulfonamide (PubChem CID 50793162) has the molecular formula C22H17N5O5S2 and a molecular weight of 495.54 g/mol. Its IUPAC name is N-(1,4-dimethyl-2,3-dioxo-7-phenoxyquinoxalin-6-yl)-2,1,3-benzothiadiazole-4-sulfonamide.
| Compound Name | N-(1,4-dimethyl-2,3-dioxo-7-phenoxyquinoxalin-6-yl)-2,1,3-benzothiadiazole-4-sulfonamide |
|---|---|
| PubChem CID | 50793162 |
| Molecular Formula | C22H17N5O5S2 |
| Molecular Weight | 495.54 g/mol |
| Exact Mass | 495.07 |
| IUPAC Name | N-(1,4-dimethyl-2,3-dioxo-7-phenoxyquinoxalin-6-yl)-2,1,3-benzothiadiazole-4-sulfonamide |
| SMILES | Cn1c(=O)c(=O)n(C)c2cc(Oc3ccccc3)c(NS(=O)(=O)c3cccc4nsnc34)cc21 |
| InChI | InChI=1S/C22H17N5O5S2/c1-26-16-11-15(25-34(30,31)19-10-6-9-14-20(19)24-33-23-14)18(32-13-7-4-3-5-8-13)12-17(16)27(2)22(29)21(26)28/h3-12,25H,1-2H3 |
| InChIKey | RJLUOQYYPUEEKI-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 125.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.54 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diazox_sulfon_A(36)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|