C24H21FN6O4 — CID 507941
1-(4-benzoylpiperazin-1-yl)-2-[4-fluoro-7-[5-(methylamino)-1,2,4-oxadiazol-3-yl]-1H-indol-3-yl]ethane-1,2-dione (PubChem CID 507941) has the molecular formula C24H21FN6O4 and a molecular weight of 476.47 g/mol. Its IUPAC name is 1-(4-benzoylpiperazin-1-yl)-2-[4-fluoro-7-[5-(methylamino)-1,2,4-oxadiazol-3-yl]-1H-indol-3-yl]ethane-1,2-dione.
| Compound Name | 1-(4-benzoylpiperazin-1-yl)-2-[4-fluoro-7-[5-(methylamino)-1,2,4-oxadiazol-3-yl]-1H-indol-3-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 507941 |
| Molecular Formula | C24H21FN6O4 |
| Molecular Weight | 476.47 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | 1-(4-benzoylpiperazin-1-yl)-2-[4-fluoro-7-[5-(methylamino)-1,2,4-oxadiazol-3-yl]-1H-indol-3-yl]ethane-1,2-dione |
| SMILES | CNc1nc(-c2ccc(F)c3c(C(=O)C(=O)N4CCN(C(=O)c5ccccc5)CC4)c[nH]c23)no1 |
| InChI | InChI=1S/C24H21FN6O4/c1-26-24-28-21(29-35-24)15-7-8-17(25)18-16(13-27-19(15)18)20(32)23(34)31-11-9-30(10-12-31)22(33)14-5-3-2-4-6-14/h2-8,13,27H,9-12H2,1H3,(H,26,28,29) |
| InChIKey | CGDYVPRNOHKHKT-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 124.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.47 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|