About 2-phenyltriazole
2-phenyltriazole (PubChem CID 5079630) has the molecular formula C8H7N3
and a molecular weight of 145.16 g/mol. Its IUPAC name is 2-phenyltriazole.
Molecular Properties
| Compound Name | 2-phenyltriazole |
| PubChem CID | 5079630 |
| Molecular Formula | C8H7N3 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.06 |
| IUPAC Name | 2-phenyltriazole |
| SMILES | c1ccc(-n2nccn2)cc1 |
| InChI | InChI=1S/C8H7N3/c1-2-4-8(5-3-1)11-9-6-7-10-11/h1-7H |
| InChIKey | JYBWAYHAOLQZJX-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-phenyltriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyltriazole?
The IUPAC name of 2-phenyltriazole (CID 5079630) is 2-phenyltriazole.
What is the SMILES notation for 2-phenyltriazole?
The canonical SMILES for 2-phenyltriazole is c1ccc(-n2nccn2)cc1.
What is the InChIKey of 2-phenyltriazole?
The InChIKey is JYBWAYHAOLQZJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3/c1-2-4-8(5-3-1)11-9-6-7-10-11/h1-7H.
What are the key properties of 2-phenyltriazole?
2-phenyltriazole has a molecular weight of 145.16 g/mol, XLogP of 1.27, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyltriazole is sourced from PubChem (CID 5079630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).