C20H21FN2O2 — CID 50797771
1-(4-fluorophenyl)-N-[2-(2-methylphenyl)ethyl]-2-oxopyrrolidine-3-carboxamide (PubChem CID 50797771) has the molecular formula C20H21FN2O2 and a molecular weight of 340.40 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-[2-(2-methylphenyl)ethyl]-2-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-N-[2-(2-methylphenyl)ethyl]-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 50797771 |
| Molecular Formula | C20H21FN2O2 |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 1-(4-fluorophenyl)-N-[2-(2-methylphenyl)ethyl]-2-oxopyrrolidine-3-carboxamide |
| SMILES | Cc1ccccc1CCNC(=O)C1CCN(c2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C20H21FN2O2/c1-14-4-2-3-5-15(14)10-12-22-19(24)18-11-13-23(20(18)25)17-8-6-16(21)7-9-17/h2-9,18H,10-13H2,1H3,(H,22,24) |
| InChIKey | QRSWQVJKRCUPDS-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|