C14H23N3O2S — CID 50798974
1-(4,5,6,7,8,9-hexahydrocycloocta[d][1,3]thiazol-2-yl)-3-(3-methoxypropyl)urea (PubChem CID 50798974) has the molecular formula C14H23N3O2S and a molecular weight of 297.42 g/mol. Its IUPAC name is 1-(4,5,6,7,8,9-hexahydrocycloocta[d][1,3]thiazol-2-yl)-3-(3-methoxypropyl)urea.
| Compound Name | 1-(4,5,6,7,8,9-hexahydrocycloocta[d][1,3]thiazol-2-yl)-3-(3-methoxypropyl)urea |
|---|---|
| PubChem CID | 50798974 |
| Molecular Formula | C14H23N3O2S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 1-(4,5,6,7,8,9-hexahydrocycloocta[d][1,3]thiazol-2-yl)-3-(3-methoxypropyl)urea |
| SMILES | COCCCNC(=O)Nc1nc2c(s1)CCCCCC2 |
| InChI | InChI=1S/C14H23N3O2S/c1-19-10-6-9-15-13(18)17-14-16-11-7-4-2-3-5-8-12(11)20-14/h2-10H2,1H3,(H2,15,16,17,18) |
| InChIKey | YQLOJCDRGARLMM-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|