C23H26N4O3S2 — CID 50799655
2-[[11-acetyl-4-(2-methylphenyl)-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-5-yl]sulfanyl]-N-propan-2-ylacetamide (PubChem CID 50799655) has the molecular formula C23H26N4O3S2 and a molecular weight of 470.62 g/mol. Its IUPAC name is 2-[[11-acetyl-4-(2-methylphenyl)-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-5-yl]sulfanyl]-N-propan-2-ylacetamide.
| Compound Name | 2-[[11-acetyl-4-(2-methylphenyl)-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-5-yl]sulfanyl]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 50799655 |
| Molecular Formula | C23H26N4O3S2 |
| Molecular Weight | 470.62 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | 2-[[11-acetyl-4-(2-methylphenyl)-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-5-yl]sulfanyl]-N-propan-2-ylacetamide |
| SMILES | CC(=O)N1CCc2c(sc3nc(SCC(=O)NC(C)C)n(-c4ccccc4C)c(=O)c23)C1 |
| InChI | InChI=1S/C23H26N4O3S2/c1-13(2)24-19(29)12-31-23-25-21-20(16-9-10-26(15(4)28)11-18(16)32-21)22(30)27(23)17-8-6-5-7-14(17)3/h5-8,13H,9-12H2,1-4H3,(H,24,29) |
| InChIKey | JNCHPMUGSDWUIN-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.62 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |