C20H18ClN5O2 — CID 50799985
(3-chlorophenyl)-[4-(3-pyridin-2-yl-1H-pyrazole-5-carbonyl)piperazin-1-yl]methanone (PubChem CID 50799985) has the molecular formula C20H18ClN5O2 and a molecular weight of 395.85 g/mol. Its IUPAC name is (3-chlorophenyl)-[4-(3-pyridin-2-yl-1H-pyrazole-5-carbonyl)piperazin-1-yl]methanone.
| Compound Name | (3-chlorophenyl)-[4-(3-pyridin-2-yl-1H-pyrazole-5-carbonyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 50799985 |
| Molecular Formula | C20H18ClN5O2 |
| Molecular Weight | 395.85 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | (3-chlorophenyl)-[4-(3-pyridin-2-yl-1H-pyrazole-5-carbonyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1cccc(Cl)c1)N1CCN(C(=O)c2cc(-c3ccccn3)n[nH]2)CC1 |
| InChI | InChI=1S/C20H18ClN5O2/c21-15-5-3-4-14(12-15)19(27)25-8-10-26(11-9-25)20(28)18-13-17(23-24-18)16-6-1-2-7-22-16/h1-7,12-13H,8-11H2,(H,23,24) |
| InChIKey | UWZMEXYNHAIKPT-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.85 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |