C27H21FN8O3 — CID 508000
1-(4-benzoylpiperazin-1-yl)-2-[4-fluoro-7-(5-pyrazin-2-yl-1H-1,2,4-triazol-3-yl)-1H-indol-3-yl]ethane-1,2-dione (PubChem CID 508000) has the molecular formula C27H21FN8O3 and a molecular weight of 524.52 g/mol. Its IUPAC name is 1-(4-benzoylpiperazin-1-yl)-2-[4-fluoro-7-(5-pyrazin-2-yl-1H-1,2,4-triazol-3-yl)-1H-indol-3-yl]ethane-1,2-dione.
| Compound Name | 1-(4-benzoylpiperazin-1-yl)-2-[4-fluoro-7-(5-pyrazin-2-yl-1H-1,2,4-triazol-3-yl)-1H-indol-3-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 508000 |
| Molecular Formula | C27H21FN8O3 |
| Molecular Weight | 524.52 g/mol |
| Exact Mass | 524.17 |
| IUPAC Name | 1-(4-benzoylpiperazin-1-yl)-2-[4-fluoro-7-(5-pyrazin-2-yl-1H-1,2,4-triazol-3-yl)-1H-indol-3-yl]ethane-1,2-dione |
| SMILES | O=C(C(=O)N1CCN(C(=O)c2ccccc2)CC1)c1c[nH]c2c(-c3n[nH]c(-c4cnccn4)n3)ccc(F)c12 |
| InChI | InChI=1S/C27H21FN8O3/c28-19-7-6-17(24-32-25(34-33-24)20-15-29-8-9-30-20)22-21(19)18(14-31-22)23(37)27(39)36-12-10-35(11-13-36)26(38)16-4-2-1-3-5-16/h1-9,14-15,31H,10-13H2,(H,32,33,34) |
| InChIKey | FARKLOYEWKXWKV-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 140.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.52 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|