C17H19N5 — CID 50800598
11-ethyl-N-(3-methylphenyl)-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine (PubChem CID 50800598) has the molecular formula C17H19N5 and a molecular weight of 293.37 g/mol. Its IUPAC name is 11-ethyl-N-(3-methylphenyl)-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine.
| Compound Name | 11-ethyl-N-(3-methylphenyl)-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine |
|---|---|
| PubChem CID | 50800598 |
| Molecular Formula | C17H19N5 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 11-ethyl-N-(3-methylphenyl)-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine |
| SMILES | CCc1nc2nc3c(c(Nc4cccc(C)c4)n2n1)CCC3 |
| InChI | InChI=1S/C17H19N5/c1-3-15-20-17-19-14-9-5-8-13(14)16(22(17)21-15)18-12-7-4-6-11(2)10-12/h4,6-7,10,18H,3,5,8-9H2,1-2H3 |
| InChIKey | QHWFPYILPXJGBK-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |