C23H21ClFN5 — CID 50801502
2-[(4-chlorophenyl)methyl]-N-[(4-fluorophenyl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-9-amine (PubChem CID 50801502) has the molecular formula C23H21ClFN5 and a molecular weight of 421.91 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methyl]-N-[(4-fluorophenyl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-9-amine.
| Compound Name | 2-[(4-chlorophenyl)methyl]-N-[(4-fluorophenyl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-9-amine |
|---|---|
| PubChem CID | 50801502 |
| Molecular Formula | C23H21ClFN5 |
| Molecular Weight | 421.91 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | 2-[(4-chlorophenyl)methyl]-N-[(4-fluorophenyl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-9-amine |
| SMILES | Fc1ccc(CNc2c3c(nc4nc(Cc5ccc(Cl)cc5)nn24)CCCC3)cc1 |
| InChI | InChI=1S/C23H21ClFN5/c24-17-9-5-15(6-10-17)13-21-28-23-27-20-4-2-1-3-19(20)22(30(23)29-21)26-14-16-7-11-18(25)12-8-16/h5-12,26H,1-4,13-14H2 |
| InChIKey | KYAYNCRGROGJIS-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.91 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |