C24H25N5 — CID 50801544
N-(4-ethylphenyl)-11-[(4-methylphenyl)methyl]-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine (PubChem CID 50801544) has the molecular formula C24H25N5 and a molecular weight of 383.50 g/mol. Its IUPAC name is N-(4-ethylphenyl)-11-[(4-methylphenyl)methyl]-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine.
| Compound Name | N-(4-ethylphenyl)-11-[(4-methylphenyl)methyl]-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine |
|---|---|
| PubChem CID | 50801544 |
| Molecular Formula | C24H25N5 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | N-(4-ethylphenyl)-11-[(4-methylphenyl)methyl]-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine |
| SMILES | CCc1ccc(Nc2c3c(nc4nc(Cc5ccc(C)cc5)nn24)CCC3)cc1 |
| InChI | InChI=1S/C24H25N5/c1-3-17-11-13-19(14-12-17)25-23-20-5-4-6-21(20)26-24-27-22(28-29(23)24)15-18-9-7-16(2)8-10-18/h7-14,25H,3-6,15H2,1-2H3 |
| InChIKey | MDTPIUVHRXDPRD-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |