C21H17ClFN5 — CID 50801597
11-[(4-chlorophenyl)methyl]-N-(3-fluorophenyl)-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine (PubChem CID 50801597) has the molecular formula C21H17ClFN5 and a molecular weight of 393.85 g/mol. Its IUPAC name is 11-[(4-chlorophenyl)methyl]-N-(3-fluorophenyl)-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine.
| Compound Name | 11-[(4-chlorophenyl)methyl]-N-(3-fluorophenyl)-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine |
|---|---|
| PubChem CID | 50801597 |
| Molecular Formula | C21H17ClFN5 |
| Molecular Weight | 393.85 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 11-[(4-chlorophenyl)methyl]-N-(3-fluorophenyl)-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine |
| SMILES | Fc1cccc(Nc2c3c(nc4nc(Cc5ccc(Cl)cc5)nn24)CCC3)c1 |
| InChI | InChI=1S/C21H17ClFN5/c22-14-9-7-13(8-10-14)11-19-26-21-25-18-6-2-5-17(18)20(28(21)27-19)24-16-4-1-3-15(23)12-16/h1,3-4,7-10,12,24H,2,5-6,11H2 |
| InChIKey | QCBUNNNPZLIRGX-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.85 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |