C44H34ClS2+ — CID 5080337
4-[2-[2-chloro-3-[2-(2,6-diphenylthiopyran-4-ylidene)ethylidene]cyclohexen-1-yl]ethenyl]-2,6-diphenylthiopyran-2-ylium (PubChem CID 5080337) has the molecular formula C44H34ClS2+ and a molecular weight of 662.34 g/mol. Its IUPAC name is 4-[2-[2-chloro-3-[2-(2,6-diphenylthiopyran-4-ylidene)ethylidene]cyclohexen-1-yl]ethenyl]-2,6-diphenylthiopyran-2-ylium.
| Compound Name | 4-[2-[2-chloro-3-[2-(2,6-diphenylthiopyran-4-ylidene)ethylidene]cyclohexen-1-yl]ethenyl]-2,6-diphenylthiopyran-2-ylium |
|---|---|
| PubChem CID | 5080337 |
| Molecular Formula | C44H34ClS2+ |
| Molecular Weight | 662.34 g/mol |
| Exact Mass | 661.18 |
| IUPAC Name | 4-[2-[2-chloro-3-[2-(2,6-diphenylthiopyran-4-ylidene)ethylidene]cyclohexen-1-yl]ethenyl]-2,6-diphenylthiopyran-2-ylium |
| SMILES | ClC1=C(C=Cc2cc(-c3ccccc3)s[c+](-c3ccccc3)c2)CCCC1=CC=C1C=C(c2ccccc2)SC(c2ccccc2)=C1 |
| InChI | InChI=1S/C44H34ClS2/c45-44-38(26-24-32-28-40(34-14-5-1-6-15-34)46-41(29-32)35-16-7-2-8-17-35)22-13-23-39(44)27-25-33-30-42(36-18-9-3-10-19-36)47-43(31-33)37-20-11-4-12-21-37/h1-12,14-21,24-31H,13,22-23H2/q+1 |
| InChIKey | LDGKYTBLPXFLOU-UHFFFAOYSA-N |
| XLogP | 13.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.34 |
| LogP ≤ 5 | 13.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|