About N-cyclopentyl-1-(3,4-difluorobenzoyl)piperidine-3-carboxamide
N-cyclopentyl-1-(3,4-difluorobenzoyl)piperidine-3-carboxamide (PubChem CID 50803880) has the molecular formula C18H22F2N2O2
and a molecular weight of 336.38 g/mol. Its IUPAC name is N-cyclopentyl-1-(3,4-difluorobenzoyl)piperidine-3-carboxamide.
Molecular Properties
| Compound Name | N-cyclopentyl-1-(3,4-difluorobenzoyl)piperidine-3-carboxamide |
| PubChem CID | 50803880 |
| Molecular Formula | C18H22F2N2O2 |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | N-cyclopentyl-1-(3,4-difluorobenzoyl)piperidine-3-carboxamide |
| SMILES | O=C(NC1CCCC1)C1CCCN(C(=O)c2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C18H22F2N2O2/c19-15-8-7-12(10-16(15)20)18(24)22-9-3-4-13(11-22)17(23)21-14-5-1-2-6-14/h7-8,10,13-14H,1-6,9,11H2,(H,21,23) |
| InChIKey | FFQSUJAXMLPYOH-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-cyclopentyl-1-(3,4-difluorobenzoyl)piperidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopentyl-1-(3,4-difluorobenzoyl)piperidine-3-carboxamide?
The IUPAC name of N-cyclopentyl-1-(3,4-difluorobenzoyl)piperidine-3-carboxamide (CID 50803880) is N-cyclopentyl-1-(3,4-difluorobenzoyl)piperidine-3-carboxamide.
What is the SMILES notation for N-cyclopentyl-1-(3,4-difluorobenzoyl)piperidine-3-carboxamide?
The canonical SMILES for N-cyclopentyl-1-(3,4-difluorobenzoyl)piperidine-3-carboxamide is O=C(NC1CCCC1)C1CCCN(C(=O)c2ccc(F)c(F)c2)C1.
What is the InChIKey of N-cyclopentyl-1-(3,4-difluorobenzoyl)piperidine-3-carboxamide?
The InChIKey is FFQSUJAXMLPYOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22F2N2O2/c19-15-8-7-12(10-16(15)20)18(24)22-9-3-4-13(11-22)17(23)21-14-5-1-2-6-14/h7-8,10,13-14H,1-6,9,11H2,(H,21,23).
What are the key properties of N-cyclopentyl-1-(3,4-difluorobenzoyl)piperidine-3-carboxamide?
N-cyclopentyl-1-(3,4-difluorobenzoyl)piperidine-3-carboxamide has a molecular weight of 336.38 g/mol, XLogP of 2.88, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopentyl-1-(3,4-difluorobenzoyl)piperidine-3-carboxamide is sourced from PubChem (CID 50803880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).