C23H18FN3O — CID 50805980
[1-(4-fluorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-pyridin-3-ylmethanone (PubChem CID 50805980) has the molecular formula C23H18FN3O and a molecular weight of 371.42 g/mol. Its IUPAC name is [1-(4-fluorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-pyridin-3-ylmethanone.
| Compound Name | [1-(4-fluorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-pyridin-3-ylmethanone |
|---|---|
| PubChem CID | 50805980 |
| Molecular Formula | C23H18FN3O |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | [1-(4-fluorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-pyridin-3-ylmethanone |
| SMILES | O=C(c1cccnc1)N1CCc2c([nH]c3ccccc23)C1c1ccc(F)cc1 |
| InChI | InChI=1S/C23H18FN3O/c24-17-9-7-15(8-10-17)22-21-19(18-5-1-2-6-20(18)26-21)11-13-27(22)23(28)16-4-3-12-25-14-16/h1-10,12,14,22,26H,11,13H2 |
| InChIKey | LCQWCGKIMFIVLO-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|