About 5'-methylspiro[adamantane-2,2'-pyrrolidine]
5'-methylspiro[adamantane-2,2'-pyrrolidine] (PubChem CID 508061) has the molecular formula C14H23N
and a molecular weight of 205.34 g/mol. Its IUPAC name is 5'-methylspiro[adamantane-2,2'-pyrrolidine].
Molecular Properties
| Compound Name | 5'-methylspiro[adamantane-2,2'-pyrrolidine] |
| PubChem CID | 508061 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | 5'-methylspiro[adamantane-2,2'-pyrrolidine] |
| SMILES | CC1CCC2(N1)C1CC3CC(C1)CC2C3 |
| InChI | InChI=1S/C14H23N/c1-9-2-3-14(15-9)12-5-10-4-11(7-12)8-13(14)6-10/h9-13,15H,2-8H2,1H3 |
| InChIKey | ORTXKEKOYJFAGF-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5'-methylspiro[adamantane-2,2'-pyrrolidine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5'-methylspiro[adamantane-2,2'-pyrrolidine]?
The IUPAC name of 5'-methylspiro[adamantane-2,2'-pyrrolidine] (CID 508061) is 5'-methylspiro[adamantane-2,2'-pyrrolidine].
What is the SMILES notation for 5'-methylspiro[adamantane-2,2'-pyrrolidine]?
The canonical SMILES for 5'-methylspiro[adamantane-2,2'-pyrrolidine] is CC1CCC2(N1)C1CC3CC(C1)CC2C3.
What is the InChIKey of 5'-methylspiro[adamantane-2,2'-pyrrolidine]?
The InChIKey is ORTXKEKOYJFAGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N/c1-9-2-3-14(15-9)12-5-10-4-11(7-12)8-13(14)6-10/h9-13,15H,2-8H2,1H3.
What are the key properties of 5'-methylspiro[adamantane-2,2'-pyrrolidine]?
5'-methylspiro[adamantane-2,2'-pyrrolidine] has a molecular weight of 205.34 g/mol, XLogP of 2.95, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5'-methylspiro[adamantane-2,2'-pyrrolidine] is sourced from PubChem (CID 508061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).