C23H25ClN4O3 — CID 50807034
5-[(2-chlorobenzoyl)amino]-2-[methyl-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]amino]benzoic acid (PubChem CID 50807034) has the molecular formula C23H25ClN4O3 and a molecular weight of 440.93 g/mol. Its IUPAC name is 5-[(2-chlorobenzoyl)amino]-2-[methyl-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]amino]benzoic acid.
| Compound Name | 5-[(2-chlorobenzoyl)amino]-2-[methyl-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]amino]benzoic acid |
|---|---|
| PubChem CID | 50807034 |
| Molecular Formula | C23H25ClN4O3 |
| Molecular Weight | 440.93 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 5-[(2-chlorobenzoyl)amino]-2-[methyl-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]amino]benzoic acid |
| SMILES | Cc1nn(C)c(C)c1CCN(C)c1ccc(NC(=O)c2ccccc2Cl)cc1C(=O)O |
| InChI | InChI=1S/C23H25ClN4O3/c1-14-17(15(2)28(4)26-14)11-12-27(3)21-10-9-16(13-19(21)23(30)31)25-22(29)18-7-5-6-8-20(18)24/h5-10,13H,11-12H2,1-4H3,(H,25,29)(H,30,31) |
| InChIKey | QLCRJCMFHJZYSA-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.93 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|