C26H32ClN3O — CID 50807667
N-butan-2-yl-1-[[1-[(2-chlorophenyl)methyl]indol-2-yl]methyl]piperidine-4-carboxamide (PubChem CID 50807667) has the molecular formula C26H32ClN3O and a molecular weight of 438.02 g/mol. Its IUPAC name is N-butan-2-yl-1-[[1-[(2-chlorophenyl)methyl]indol-2-yl]methyl]piperidine-4-carboxamide.
| Compound Name | N-butan-2-yl-1-[[1-[(2-chlorophenyl)methyl]indol-2-yl]methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 50807667 |
| Molecular Formula | C26H32ClN3O |
| Molecular Weight | 438.02 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | N-butan-2-yl-1-[[1-[(2-chlorophenyl)methyl]indol-2-yl]methyl]piperidine-4-carboxamide |
| SMILES | CCC(C)NC(=O)C1CCN(Cc2cc3ccccc3n2Cc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C26H32ClN3O/c1-3-19(2)28-26(31)20-12-14-29(15-13-20)18-23-16-21-8-5-7-11-25(21)30(23)17-22-9-4-6-10-24(22)27/h4-11,16,19-20H,3,12-15,17-18H2,1-2H3,(H,28,31) |
| InChIKey | BVEZEEDTQLRNPP-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.02 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |