About 4-[[2-(5-propyl-1,2-oxazol-3-yl)pyrrolidin-1-yl]methyl]phenol
4-[[2-(5-propyl-1,2-oxazol-3-yl)pyrrolidin-1-yl]methyl]phenol (PubChem CID 50808735) has the molecular formula C17H22N2O2
and a molecular weight of 286.38 g/mol. Its IUPAC name is 4-[[2-(5-propyl-1,2-oxazol-3-yl)pyrrolidin-1-yl]methyl]phenol.
Molecular Properties
| Compound Name | 4-[[2-(5-propyl-1,2-oxazol-3-yl)pyrrolidin-1-yl]methyl]phenol |
| PubChem CID | 50808735 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 4-[[2-(5-propyl-1,2-oxazol-3-yl)pyrrolidin-1-yl]methyl]phenol |
| SMILES | CCCc1cc(C2CCCN2Cc2ccc(O)cc2)no1 |
| InChI | InChI=1S/C17H22N2O2/c1-2-4-15-11-16(18-21-15)17-5-3-10-19(17)12-13-6-8-14(20)9-7-13/h6-9,11,17,20H,2-5,10,12H2,1H3 |
| InChIKey | OXVNXBDDDLNHDD-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 49.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[[2-(5-propyl-1,2-oxazol-3-yl)pyrrolidin-1-yl]methyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[2-(5-propyl-1,2-oxazol-3-yl)pyrrolidin-1-yl]methyl]phenol?
The IUPAC name of 4-[[2-(5-propyl-1,2-oxazol-3-yl)pyrrolidin-1-yl]methyl]phenol (CID 50808735) is 4-[[2-(5-propyl-1,2-oxazol-3-yl)pyrrolidin-1-yl]methyl]phenol.
What is the SMILES notation for 4-[[2-(5-propyl-1,2-oxazol-3-yl)pyrrolidin-1-yl]methyl]phenol?
The canonical SMILES for 4-[[2-(5-propyl-1,2-oxazol-3-yl)pyrrolidin-1-yl]methyl]phenol is CCCc1cc(C2CCCN2Cc2ccc(O)cc2)no1.
What is the InChIKey of 4-[[2-(5-propyl-1,2-oxazol-3-yl)pyrrolidin-1-yl]methyl]phenol?
The InChIKey is OXVNXBDDDLNHDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N2O2/c1-2-4-15-11-16(18-21-15)17-5-3-10-19(17)12-13-6-8-14(20)9-7-13/h6-9,11,17,20H,2-5,10,12H2,1H3.
What are the key properties of 4-[[2-(5-propyl-1,2-oxazol-3-yl)pyrrolidin-1-yl]methyl]phenol?
4-[[2-(5-propyl-1,2-oxazol-3-yl)pyrrolidin-1-yl]methyl]phenol has a molecular weight of 286.38 g/mol, XLogP of 3.67, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[2-(5-propyl-1,2-oxazol-3-yl)pyrrolidin-1-yl]methyl]phenol is sourced from PubChem (CID 50808735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).