About 4-[1-[(1,3-dimethylpyrazol-4-yl)methyl]pyrrolidin-2-yl]-5-ethyl-3-methyl-1,2-oxazole
4-[1-[(1,3-dimethylpyrazol-4-yl)methyl]pyrrolidin-2-yl]-5-ethyl-3-methyl-1,2-oxazole (PubChem CID 50808787) has the molecular formula C16H24N4O
and a molecular weight of 288.39 g/mol. Its IUPAC name is 4-[1-[(1,3-dimethylpyrazol-4-yl)methyl]pyrrolidin-2-yl]-5-ethyl-3-methyl-1,2-oxazole.
Molecular Properties
| Compound Name | 4-[1-[(1,3-dimethylpyrazol-4-yl)methyl]pyrrolidin-2-yl]-5-ethyl-3-methyl-1,2-oxazole |
| PubChem CID | 50808787 |
| Molecular Formula | C16H24N4O |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | 4-[1-[(1,3-dimethylpyrazol-4-yl)methyl]pyrrolidin-2-yl]-5-ethyl-3-methyl-1,2-oxazole |
| SMILES | CCc1onc(C)c1C1CCCN1Cc1cn(C)nc1C |
| InChI | InChI=1S/C16H24N4O/c1-5-15-16(12(3)18-21-15)14-7-6-8-20(14)10-13-9-19(4)17-11(13)2/h9,14H,5-8,10H2,1-4H3 |
| InChIKey | MBDXSSXRSBXZBH-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 47.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[1-[(1,3-dimethylpyrazol-4-yl)methyl]pyrrolidin-2-yl]-5-ethyl-3-methyl-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-[(1,3-dimethylpyrazol-4-yl)methyl]pyrrolidin-2-yl]-5-ethyl-3-methyl-1,2-oxazole?
The IUPAC name of 4-[1-[(1,3-dimethylpyrazol-4-yl)methyl]pyrrolidin-2-yl]-5-ethyl-3-methyl-1,2-oxazole (CID 50808787) is 4-[1-[(1,3-dimethylpyrazol-4-yl)methyl]pyrrolidin-2-yl]-5-ethyl-3-methyl-1,2-oxazole.
What is the SMILES notation for 4-[1-[(1,3-dimethylpyrazol-4-yl)methyl]pyrrolidin-2-yl]-5-ethyl-3-methyl-1,2-oxazole?
The canonical SMILES for 4-[1-[(1,3-dimethylpyrazol-4-yl)methyl]pyrrolidin-2-yl]-5-ethyl-3-methyl-1,2-oxazole is CCc1onc(C)c1C1CCCN1Cc1cn(C)nc1C.
What is the InChIKey of 4-[1-[(1,3-dimethylpyrazol-4-yl)methyl]pyrrolidin-2-yl]-5-ethyl-3-methyl-1,2-oxazole?
The InChIKey is MBDXSSXRSBXZBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N4O/c1-5-15-16(12(3)18-21-15)14-7-6-8-20(14)10-13-9-19(4)17-11(13)2/h9,14H,5-8,10H2,1-4H3.
What are the key properties of 4-[1-[(1,3-dimethylpyrazol-4-yl)methyl]pyrrolidin-2-yl]-5-ethyl-3-methyl-1,2-oxazole?
4-[1-[(1,3-dimethylpyrazol-4-yl)methyl]pyrrolidin-2-yl]-5-ethyl-3-methyl-1,2-oxazole has a molecular weight of 288.39 g/mol, XLogP of 2.92, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-[(1,3-dimethylpyrazol-4-yl)methyl]pyrrolidin-2-yl]-5-ethyl-3-methyl-1,2-oxazole is sourced from PubChem (CID 50808787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).