C30H31N3O3 — CID 50811268
6-(4-methoxyphenyl)-9,9-dimethyl-N-(2-methylphenyl)-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepine-5-carboxamide (PubChem CID 50811268) has the molecular formula C30H31N3O3 and a molecular weight of 481.60 g/mol. Its IUPAC name is 6-(4-methoxyphenyl)-9,9-dimethyl-N-(2-methylphenyl)-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepine-5-carboxamide.
| Compound Name | 6-(4-methoxyphenyl)-9,9-dimethyl-N-(2-methylphenyl)-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepine-5-carboxamide |
|---|---|
| PubChem CID | 50811268 |
| Molecular Formula | C30H31N3O3 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | 6-(4-methoxyphenyl)-9,9-dimethyl-N-(2-methylphenyl)-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepine-5-carboxamide |
| SMILES | COc1ccc(C2C3=C(CC(C)(C)CC3=O)Nc3ccccc3N2C(=O)Nc2ccccc2C)cc1 |
| InChI | InChI=1S/C30H31N3O3/c1-19-9-5-6-10-22(19)32-29(35)33-25-12-8-7-11-23(25)31-24-17-30(2,3)18-26(34)27(24)28(33)20-13-15-21(36-4)16-14-20/h5-16,28,31H,17-18H2,1-4H3,(H,32,35) |
| InChIKey | PSTYGNJMEYYHTE-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |