C23H21NO3S — CID 50811599
3-(4-methoxyphenyl)-7-(4-prop-2-enoxyphenyl)-6,7-dihydro-4H-thieno[3,2-b]pyridin-5-one (PubChem CID 50811599) has the molecular formula C23H21NO3S and a molecular weight of 391.49 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-7-(4-prop-2-enoxyphenyl)-6,7-dihydro-4H-thieno[3,2-b]pyridin-5-one.
| Compound Name | 3-(4-methoxyphenyl)-7-(4-prop-2-enoxyphenyl)-6,7-dihydro-4H-thieno[3,2-b]pyridin-5-one |
|---|---|
| PubChem CID | 50811599 |
| Molecular Formula | C23H21NO3S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 3-(4-methoxyphenyl)-7-(4-prop-2-enoxyphenyl)-6,7-dihydro-4H-thieno[3,2-b]pyridin-5-one |
| SMILES | C=CCOc1ccc(C2CC(=O)Nc3c(-c4ccc(OC)cc4)csc32)cc1 |
| InChI | InChI=1S/C23H21NO3S/c1-3-12-27-18-10-6-15(7-11-18)19-13-21(25)24-22-20(14-28-23(19)22)16-4-8-17(26-2)9-5-16/h3-11,14,19H,1,12-13H2,2H3,(H,24,25) |
| InChIKey | LFMJHENSMDOHQD-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|