C20H15F3N6O2S — CID 50811765
N-(2,6-difluorophenyl)-3-[3-[[5-(3-fluorophenyl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]-1,2,4-oxadiazol-5-yl]propanamide (PubChem CID 50811765) has the molecular formula C20H15F3N6O2S and a molecular weight of 460.44 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-3-[3-[[5-(3-fluorophenyl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]-1,2,4-oxadiazol-5-yl]propanamide.
| Compound Name | N-(2,6-difluorophenyl)-3-[3-[[5-(3-fluorophenyl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]-1,2,4-oxadiazol-5-yl]propanamide |
|---|---|
| PubChem CID | 50811765 |
| Molecular Formula | C20H15F3N6O2S |
| Molecular Weight | 460.44 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | N-(2,6-difluorophenyl)-3-[3-[[5-(3-fluorophenyl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]-1,2,4-oxadiazol-5-yl]propanamide |
| SMILES | O=C(CCc1nc(CSc2n[nH]c(-c3cccc(F)c3)n2)no1)Nc1c(F)cccc1F |
| InChI | InChI=1S/C20H15F3N6O2S/c21-12-4-1-3-11(9-12)19-26-20(28-27-19)32-10-15-24-17(31-29-15)8-7-16(30)25-18-13(22)5-2-6-14(18)23/h1-6,9H,7-8,10H2,(H,25,30)(H,26,27,28) |
| InChIKey | SLXOVCXNRURHFE-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 109.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.44 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |