C22H22N4O4 — CID 50812901
2-[5-acetamido-3-(4-methylphenyl)-6-oxopyridazin-1-yl]-N-(2-methoxyphenyl)acetamide (PubChem CID 50812901) has the molecular formula C22H22N4O4 and a molecular weight of 406.44 g/mol. Its IUPAC name is 2-[5-acetamido-3-(4-methylphenyl)-6-oxopyridazin-1-yl]-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-[5-acetamido-3-(4-methylphenyl)-6-oxopyridazin-1-yl]-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 50812901 |
| Molecular Formula | C22H22N4O4 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 2-[5-acetamido-3-(4-methylphenyl)-6-oxopyridazin-1-yl]-N-(2-methoxyphenyl)acetamide |
| SMILES | COc1ccccc1NC(=O)Cn1nc(-c2ccc(C)cc2)cc(NC(C)=O)c1=O |
| InChI | InChI=1S/C22H22N4O4/c1-14-8-10-16(11-9-14)18-12-19(23-15(2)27)22(29)26(25-18)13-21(28)24-17-6-4-5-7-20(17)30-3/h4-12H,13H2,1-3H3,(H,23,27)(H,24,28) |
| InChIKey | XQJVAXPNIJFXIN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |